C40H53N2+ — CID 59898916
3-butyl-1,1-dimethyl-2-[(E,3Z)-3-(3,3,5-trimethyl-1-octylindol-2-ylidene)prop-1-enyl]benzo[e]indol-3-ium (PubChem CID 59898916) has the molecular formula C40H53N2+ and a molecular weight of 561.88 g/mol. Its IUPAC name is 3-butyl-1,1-dimethyl-2-[(E,3Z)-3-(3,3,5-trimethyl-1-octylindol-2-ylidene)prop-1-enyl]benzo[e]indol-3-ium.
| Compound Name | 3-butyl-1,1-dimethyl-2-[(E,3Z)-3-(3,3,5-trimethyl-1-octylindol-2-ylidene)prop-1-enyl]benzo[e]indol-3-ium |
|---|---|
| PubChem CID | 59898916 |
| Molecular Formula | C40H53N2+ |
| Molecular Weight | 561.88 g/mol |
| Exact Mass | 561.42 |
| IUPAC Name | 3-butyl-1,1-dimethyl-2-[(E,3Z)-3-(3,3,5-trimethyl-1-octylindol-2-ylidene)prop-1-enyl]benzo[e]indol-3-ium |
| SMILES | CCCCCCCCN1/C(=C\C=C\C2=[N+](CCCC)c3ccc4ccccc4c3C2(C)C)C(C)(C)c2cc(C)ccc21 |
| InChI | InChI=1S/C40H53N2/c1-8-10-12-13-14-17-28-41-34-25-23-30(3)29-33(34)39(4,5)36(41)21-18-22-37-40(6,7)38-32-20-16-15-19-31(32)24-26-35(38)42(37)27-11-9-2/h15-16,18-26,29H,8-14,17,27-28H2,1-7H3/q+1 |
| InChIKey | WTMSNSUGFYCETL-UHFFFAOYSA-N |
| XLogP | 10.92 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.88 |
| LogP ≤ 5 | 10.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|