C35H40N2O9S3-2 — CID 59086682
4-[2-[3-[1,1-dimethyl-3-(4-sulfonatobutyl)benzo[e]indol-3-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-5-oxidoperoxysulfanylindol-1-yl]butane-1-sulfonate (PubChem CID 59086682) has the molecular formula C35H40N2O9S3-2 and a molecular weight of 728.91 g/mol. Its IUPAC name is 4-[2-[3-[1,1-dimethyl-3-(4-sulfonatobutyl)benzo[e]indol-3-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-5-oxidoperoxysulfanylindol-1-yl]butane-1-sulfonate.
| Compound Name | 4-[2-[3-[1,1-dimethyl-3-(4-sulfonatobutyl)benzo[e]indol-3-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-5-oxidoperoxysulfanylindol-1-yl]butane-1-sulfonate |
|---|---|
| PubChem CID | 59086682 |
| Molecular Formula | C35H40N2O9S3-2 |
| Molecular Weight | 728.91 g/mol |
| Exact Mass | 728.19 |
| IUPAC Name | 4-[2-[3-[1,1-dimethyl-3-(4-sulfonatobutyl)benzo[e]indol-3-ium-2-yl]prop-2-enylidene]-3,3-dimethyl-5-oxidoperoxysulfanylindol-1-yl]butane-1-sulfonate |
| SMILES | CC1(C)C(=CC=CC2=[N+](CCCCS(=O)(=O)[O-])c3ccc4ccccc4c3C2(C)C)N(CCCCS(=O)(=O)[O-])c2ccc(SOO[O-])cc21 |
| InChI | InChI=1S/C35H42N2O9S3/c1-34(2)28-24-26(47-46-45-38)17-19-29(28)36(20-7-9-22-48(39,40)41)31(34)14-11-15-32-35(3,4)33-27-13-6-5-12-25(27)16-18-30(33)37(32)21-8-10-23-49(42,43)44/h5-6,11-19,24H,7-10,20-23H2,1-4H3,(H2-,38,39,40,41,42,43,44)/p-2 |
| InChIKey | BRZUMZUJHXOJOV-UHFFFAOYSA-L |
| XLogP | 5.34 |
| TPSA | 162.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.91 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|