C42H47N2O6S2- — CID 59086716
4-[2-[5-[1,1-dimethyl-3-(4-sulfonatobutyl)benzo[e]indol-3-ium-2-yl]-3-methylpenta-2,4-dienylidene]-1,1-dimethylbenzo[e]indol-3-yl]butane-1-sulfonate (PubChem CID 59086716) has the molecular formula C42H47N2O6S2- and a molecular weight of 739.98 g/mol. Its IUPAC name is 4-[2-[5-[1,1-dimethyl-3-(4-sulfonatobutyl)benzo[e]indol-3-ium-2-yl]-3-methylpenta-2,4-dienylidene]-1,1-dimethylbenzo[e]indol-3-yl]butane-1-sulfonate.
| Compound Name | 4-[2-[5-[1,1-dimethyl-3-(4-sulfonatobutyl)benzo[e]indol-3-ium-2-yl]-3-methylpenta-2,4-dienylidene]-1,1-dimethylbenzo[e]indol-3-yl]butane-1-sulfonate |
|---|---|
| PubChem CID | 59086716 |
| Molecular Formula | C42H47N2O6S2- |
| Molecular Weight | 739.98 g/mol |
| Exact Mass | 739.29 |
| IUPAC Name | 4-[2-[5-[1,1-dimethyl-3-(4-sulfonatobutyl)benzo[e]indol-3-ium-2-yl]-3-methylpenta-2,4-dienylidene]-1,1-dimethylbenzo[e]indol-3-yl]butane-1-sulfonate |
| SMILES | CC(C=CC1=[N+](CCCCS(=O)(=O)[O-])c2ccc3ccccc3c2C1(C)C)=CC=C1N(CCCCS(=O)(=O)[O-])c2ccc3ccccc3c2C1(C)C |
| InChI | InChI=1S/C42H48N2O6S2/c1-30(18-24-37-41(2,3)39-33-16-8-6-14-31(33)20-22-35(39)43(37)26-10-12-28-51(45,46)47)19-25-38-42(4,5)40-34-17-9-7-15-32(34)21-23-36(40)44(38)27-11-13-29-52(48,49)50/h6-9,14-25H,10-13,26-29H2,1-5H3,(H-,45,46,47,48,49,50)/p-1 |
| InChIKey | WKUGAEAONMRIPC-UHFFFAOYSA-M |
| XLogP | 8.20 |
| TPSA | 120.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.98 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|