C58H67BN2 — CID 89314824
3-butyl-2-[(1E,3E,5Z)-5-(3,3-dimethyl-1-propylindol-2-ylidene)penta-1,3-dienyl]-1,1-dimethylbenzo[e]indol-3-ium;butyl(triphenyl)boranuide (PubChem CID 89314824) has the molecular formula C58H67BN2 and a molecular weight of 803.00 g/mol. Its IUPAC name is 3-butyl-2-[(1E,3E,5Z)-5-(3,3-dimethyl-1-propylindol-2-ylidene)penta-1,3-dienyl]-1,1-dimethylbenzo[e]indol-3-ium;butyl(triphenyl)boranuide.
| Compound Name | 3-butyl-2-[(1E,3E,5Z)-5-(3,3-dimethyl-1-propylindol-2-ylidene)penta-1,3-dienyl]-1,1-dimethylbenzo[e]indol-3-ium;butyl(triphenyl)boranuide |
|---|---|
| PubChem CID | 89314824 |
| Molecular Formula | C58H67BN2 |
| Molecular Weight | 803.00 g/mol |
| Exact Mass | 802.54 |
| IUPAC Name | 3-butyl-2-[(1E,3E,5Z)-5-(3,3-dimethyl-1-propylindol-2-ylidene)penta-1,3-dienyl]-1,1-dimethylbenzo[e]indol-3-ium;butyl(triphenyl)boranuide |
| SMILES | CCCC[B-](c1ccccc1)(c1ccccc1)c1ccccc1.CCCC[N+]1=C(/C=C/C=C/C=C2\N(CCC)c3ccccc3C2(C)C)C(C)(C)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C36H43N2.C22H24B/c1-7-9-26-38-31-24-23-27-17-13-14-18-28(27)34(31)36(5,6)33(38)22-12-10-11-21-32-35(3,4)29-19-15-16-20-30(29)37(32)25-8-2;1-2-3-19-23(20-13-7-4-8-14-20,21-15-9-5-10-16-21)22-17-11-6-12-18-22/h10-24H,7-9,25-26H2,1-6H3;4-18H,2-3,19H2,1H3/q+1;-1 |
| InChIKey | ZAMQNZNCXYPIDD-UHFFFAOYSA-N |
| XLogP | 13.18 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.00 |
| LogP ≤ 5 | 13.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|