C36H46N3O2S+ — CID 72591187
N-[2-[3-(3-butyl-1,1-dimethylbenzo[e]indol-2-ylidene)prop-1-enyl]-1,3,3-trimethylindol-1-ium-5-yl]sulfanylperoxy-N-ethylethanamine (PubChem CID 72591187) has the molecular formula C36H46N3O2S+ and a molecular weight of 584.85 g/mol. Its IUPAC name is N-[2-[3-(3-butyl-1,1-dimethylbenzo[e]indol-2-ylidene)prop-1-enyl]-1,3,3-trimethylindol-1-ium-5-yl]sulfanylperoxy-N-ethylethanamine.
| Compound Name | N-[2-[3-(3-butyl-1,1-dimethylbenzo[e]indol-2-ylidene)prop-1-enyl]-1,3,3-trimethylindol-1-ium-5-yl]sulfanylperoxy-N-ethylethanamine |
|---|---|
| PubChem CID | 72591187 |
| Molecular Formula | C36H46N3O2S+ |
| Molecular Weight | 584.85 g/mol |
| Exact Mass | 584.33 |
| IUPAC Name | N-[2-[3-(3-butyl-1,1-dimethylbenzo[e]indol-2-ylidene)prop-1-enyl]-1,3,3-trimethylindol-1-ium-5-yl]sulfanylperoxy-N-ethylethanamine |
| SMILES | CCCCN1C(=CC=CC2=[N+](C)c3ccc(SOON(CC)CC)cc3C2(C)C)C(C)(C)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C36H46N3O2S/c1-9-12-24-39-31-22-20-26-16-13-14-17-28(26)34(31)36(6,7)33(39)19-15-18-32-35(4,5)29-25-27(21-23-30(29)37(32)8)42-41-40-38(10-2)11-3/h13-23,25H,9-12,24H2,1-8H3/q+1 |
| InChIKey | IVRLPBXOSBWEQV-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 27.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.85 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|