C30H32ClN2+ — CID 58747417
(2E)-2-[(E)-3-(5-chloro-1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]-1-ethyl-1,3-dimethylbenzo[e]indole (PubChem CID 58747417) has the molecular formula C30H32ClN2+ and a molecular weight of 456.05 g/mol. Its IUPAC name is (2E)-2-[(E)-3-(5-chloro-1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]-1-ethyl-1,3-dimethylbenzo[e]indole.
| Compound Name | (2E)-2-[(E)-3-(5-chloro-1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]-1-ethyl-1,3-dimethylbenzo[e]indole |
|---|---|
| PubChem CID | 58747417 |
| Molecular Formula | C30H32ClN2+ |
| Molecular Weight | 456.05 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | (2E)-2-[(E)-3-(5-chloro-1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]-1-ethyl-1,3-dimethylbenzo[e]indole |
| SMILES | CCC1(C)/C(=C\C=C\C2=[N+](C)c3ccc(Cl)cc3C2(C)C)N(C)c2ccc3ccccc3c21 |
| InChI | InChI=1S/C30H32ClN2/c1-7-30(4)27(33(6)25-17-15-20-11-8-9-12-22(20)28(25)30)14-10-13-26-29(2,3)23-19-21(31)16-18-24(23)32(26)5/h8-19H,7H2,1-6H3/q+1 |
| InChIKey | BZKQPLUPYGMTTF-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.05 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|