C31H33N2O+ — CID 59207695
1-[(2E)-1,3-dimethyl-2-[(E)-3-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)prop-2-enylidene]indol-3-yl]propan-2-one (PubChem CID 59207695) has the molecular formula C31H33N2O+ and a molecular weight of 449.62 g/mol. Its IUPAC name is 1-[(2E)-1,3-dimethyl-2-[(E)-3-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)prop-2-enylidene]indol-3-yl]propan-2-one.
| Compound Name | 1-[(2E)-1,3-dimethyl-2-[(E)-3-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)prop-2-enylidene]indol-3-yl]propan-2-one |
|---|---|
| PubChem CID | 59207695 |
| Molecular Formula | C31H33N2O+ |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.26 |
| IUPAC Name | 1-[(2E)-1,3-dimethyl-2-[(E)-3-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)prop-2-enylidene]indol-3-yl]propan-2-one |
| SMILES | CC(=O)CC1(C)/C(=C\C=C\C2=[N+](C)c3ccc4ccccc4c3C2(C)C)N(C)c2ccccc21 |
| InChI | InChI=1S/C31H33N2O/c1-21(34)20-31(4)24-14-9-10-15-25(24)32(5)28(31)17-11-16-27-30(2,3)29-23-13-8-7-12-22(23)18-19-26(29)33(27)6/h7-19H,20H2,1-6H3/q+1 |
| InChIKey | CDPBOOUUMXICGI-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 23.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|