C34H37N2+ — CID 59207676
2-[(E,3E)-3-(3-cyclohex-2-en-1-yl-1,3-dimethylindol-2-ylidene)prop-1-enyl]-1,1,3-trimethylbenzo[e]indol-3-ium (PubChem CID 59207676) has the molecular formula C34H37N2+ and a molecular weight of 473.68 g/mol. Its IUPAC name is 2-[(E,3E)-3-(3-cyclohex-2-en-1-yl-1,3-dimethylindol-2-ylidene)prop-1-enyl]-1,1,3-trimethylbenzo[e]indol-3-ium.
| Compound Name | 2-[(E,3E)-3-(3-cyclohex-2-en-1-yl-1,3-dimethylindol-2-ylidene)prop-1-enyl]-1,1,3-trimethylbenzo[e]indol-3-ium |
|---|---|
| PubChem CID | 59207676 |
| Molecular Formula | C34H37N2+ |
| Molecular Weight | 473.68 g/mol |
| Exact Mass | 473.30 |
| IUPAC Name | 2-[(E,3E)-3-(3-cyclohex-2-en-1-yl-1,3-dimethylindol-2-ylidene)prop-1-enyl]-1,1,3-trimethylbenzo[e]indol-3-ium |
| SMILES | CN1/C(=C/C=C/C2=[N+](C)c3ccc4ccccc4c3C2(C)C)C(C)(C2C=CCCC2)c2ccccc21 |
| InChI | InChI=1S/C34H37N2/c1-33(2)30(36(5)29-23-22-24-14-9-10-17-26(24)32(29)33)20-13-21-31-34(3,25-15-7-6-8-16-25)27-18-11-12-19-28(27)35(31)4/h7,9-15,17-23,25H,6,8,16H2,1-5H3/q+1 |
| InChIKey | XVFDJTQBFZINJZ-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.68 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|