C41H41N2+ — CID 58434261
(2E)-3-methyl-2-[(2E,4E,6E,8E)-9-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)nona-2,4,6,8-tetraenylidene]spiro[benzo[e]indole-1,1'-cyclopentane] (PubChem CID 58434261) has the molecular formula C41H41N2+ and a molecular weight of 561.79 g/mol. Its IUPAC name is (2E)-3-methyl-2-[(2E,4E,6E,8E)-9-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)nona-2,4,6,8-tetraenylidene]spiro[benzo[e]indole-1,1'-cyclopentane].
| Compound Name | (2E)-3-methyl-2-[(2E,4E,6E,8E)-9-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)nona-2,4,6,8-tetraenylidene]spiro[benzo[e]indole-1,1'-cyclopentane] |
|---|---|
| PubChem CID | 58434261 |
| Molecular Formula | C41H41N2+ |
| Molecular Weight | 561.79 g/mol |
| Exact Mass | 561.33 |
| IUPAC Name | (2E)-3-methyl-2-[(2E,4E,6E,8E)-9-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)nona-2,4,6,8-tetraenylidene]spiro[benzo[e]indole-1,1'-cyclopentane] |
| SMILES | CN1/C(=C/C=C/C=C/C=C/C=C/C2=[N+](C)c3ccc4ccccc4c3C2(C)C)C2(CCCC2)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C41H41N2/c1-40(2)36(42(3)34-26-24-30-18-12-14-20-32(30)38(34)40)22-10-8-6-5-7-9-11-23-37-41(28-16-17-29-41)39-33-21-15-13-19-31(33)25-27-35(39)43(37)4/h5-15,18-27H,16-17,28-29H2,1-4H3/q+1 |
| InChIKey | PUAYSSSMVODREU-UHFFFAOYSA-N |
| XLogP | 10.07 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.79 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|