C32H33BrN3O2+ — CID 76584502
6'-bromo-1'-methyl-5'-nitro-2'-[3-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)prop-2-enylidene]spiro[cyclohexane-1,3'-indole] (PubChem CID 76584502) has the molecular formula C32H33BrN3O2+ and a molecular weight of 571.54 g/mol. Its IUPAC name is 6'-bromo-1'-methyl-5'-nitro-2'-[3-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)prop-2-enylidene]spiro[cyclohexane-1,3'-indole].
| Compound Name | 6'-bromo-1'-methyl-5'-nitro-2'-[3-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)prop-2-enylidene]spiro[cyclohexane-1,3'-indole] |
|---|---|
| PubChem CID | 76584502 |
| Molecular Formula | C32H33BrN3O2+ |
| Molecular Weight | 571.54 g/mol |
| Exact Mass | 570.18 |
| IUPAC Name | 6'-bromo-1'-methyl-5'-nitro-2'-[3-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)prop-2-enylidene]spiro[cyclohexane-1,3'-indole] |
| SMILES | CN1C(=CC=CC2=[N+](C)c3ccc4ccccc4c3C2(C)C)C2(CCCCC2)c2cc([N+](=O)[O-])c(Br)cc21 |
| InChI | InChI=1S/C32H33BrN3O2/c1-31(2)28(34(3)25-16-15-21-11-6-7-12-22(21)30(25)31)13-10-14-29-32(17-8-5-9-18-32)23-19-27(36(37)38)24(33)20-26(23)35(29)4/h6-7,10-16,19-20H,5,8-9,17-18H2,1-4H3/q+1 |
| InChIKey | IFBRPCYFZRKAFF-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.54 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|