C47H51N2+ — CID 58434266
2-[(1E,3E,5E,7E,9E)-4,6-dimethyl-9-(3-methylspiro[benzo[e]indole-1,1'-cyclohexane]-2-ylidene)nona-1,3,5,7-tetraenyl]-3-methylspiro[benzo[e]indol-3-ium-1,1'-cyclohexane] (PubChem CID 58434266) has the molecular formula C47H51N2+ and a molecular weight of 643.94 g/mol. Its IUPAC name is 2-[(1E,3E,5E,7E,9E)-4,6-dimethyl-9-(3-methylspiro[benzo[e]indole-1,1'-cyclohexane]-2-ylidene)nona-1,3,5,7-tetraenyl]-3-methylspiro[benzo[e]indol-3-ium-1,1'-cyclohexane].
| Compound Name | 2-[(1E,3E,5E,7E,9E)-4,6-dimethyl-9-(3-methylspiro[benzo[e]indole-1,1'-cyclohexane]-2-ylidene)nona-1,3,5,7-tetraenyl]-3-methylspiro[benzo[e]indol-3-ium-1,1'-cyclohexane] |
|---|---|
| PubChem CID | 58434266 |
| Molecular Formula | C47H51N2+ |
| Molecular Weight | 643.94 g/mol |
| Exact Mass | 643.40 |
| IUPAC Name | 2-[(1E,3E,5E,7E,9E)-4,6-dimethyl-9-(3-methylspiro[benzo[e]indole-1,1'-cyclohexane]-2-ylidene)nona-1,3,5,7-tetraenyl]-3-methylspiro[benzo[e]indol-3-ium-1,1'-cyclohexane] |
| SMILES | CC(=C\C=C\C1=[N+](C)c2ccc3ccccc3c2C12CCCCC2)/C=C(C)/C=C/C=C1/N(C)c2ccc3ccccc3c2C12CCCCC2 |
| InChI | InChI=1S/C47H51N2/c1-34(17-15-23-42-46(29-11-5-12-30-46)44-38-21-9-7-19-36(38)25-27-40(44)48(42)3)33-35(2)18-16-24-43-47(31-13-6-14-32-47)45-39-22-10-8-20-37(39)26-28-41(45)49(43)4/h7-10,15-28,33H,5-6,11-14,29-32H2,1-4H3/q+1 |
| InChIKey | DOPJYNDVGTXGJJ-UHFFFAOYSA-N |
| XLogP | 12.16 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.94 |
| LogP ≤ 5 | 12.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|