C38H38N3+ — CID 76593861
2-[5-[1,3-dimethyl-3-(pyridin-2-ylmethyl)indol-2-ylidene]penta-1,3-dienyl]-3-methylspiro[benzo[e]indol-3-ium-1,1'-cyclopentane] (PubChem CID 76593861) has the molecular formula C38H38N3+ and a molecular weight of 536.74 g/mol. Its IUPAC name is 2-[5-[1,3-dimethyl-3-(pyridin-2-ylmethyl)indol-2-ylidene]penta-1,3-dienyl]-3-methylspiro[benzo[e]indol-3-ium-1,1'-cyclopentane].
| Compound Name | 2-[5-[1,3-dimethyl-3-(pyridin-2-ylmethyl)indol-2-ylidene]penta-1,3-dienyl]-3-methylspiro[benzo[e]indol-3-ium-1,1'-cyclopentane] |
|---|---|
| PubChem CID | 76593861 |
| Molecular Formula | C38H38N3+ |
| Molecular Weight | 536.74 g/mol |
| Exact Mass | 536.31 |
| IUPAC Name | 2-[5-[1,3-dimethyl-3-(pyridin-2-ylmethyl)indol-2-ylidene]penta-1,3-dienyl]-3-methylspiro[benzo[e]indol-3-ium-1,1'-cyclopentane] |
| SMILES | CN1C(=CC=CC=CC2=[N+](C)c3ccc4ccccc4c3C23CCCC3)C(C)(Cc2ccccn2)c2ccccc21 |
| InChI | InChI=1S/C38H38N3/c1-37(27-29-16-11-14-26-39-29)31-18-9-10-19-32(31)40(2)34(37)20-5-4-6-21-35-38(24-12-13-25-38)36-30-17-8-7-15-28(30)22-23-33(36)41(35)3/h4-11,14-23,26H,12-13,24-25,27H2,1-3H3/q+1 |
| InChIKey | JAHPBKQZGJGGMR-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 19.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.74 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|