C42H43N2O2+ — CID 59137795
3-[(2E)-3-benzyl-3-methyl-2-[(2E,4E)-5-(1-methylspiro[benzo[g]indol-1-ium-3,1'-cyclohexane]-2-yl)penta-2,4-dienylidene]indol-1-yl]propanoic acid (PubChem CID 59137795) has the molecular formula C42H43N2O2+ and a molecular weight of 607.82 g/mol. Its IUPAC name is 3-[(2E)-3-benzyl-3-methyl-2-[(2E,4E)-5-(1-methylspiro[benzo[g]indol-1-ium-3,1'-cyclohexane]-2-yl)penta-2,4-dienylidene]indol-1-yl]propanoic acid.
| Compound Name | 3-[(2E)-3-benzyl-3-methyl-2-[(2E,4E)-5-(1-methylspiro[benzo[g]indol-1-ium-3,1'-cyclohexane]-2-yl)penta-2,4-dienylidene]indol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 59137795 |
| Molecular Formula | C42H43N2O2+ |
| Molecular Weight | 607.82 g/mol |
| Exact Mass | 607.33 |
| IUPAC Name | 3-[(2E)-3-benzyl-3-methyl-2-[(2E,4E)-5-(1-methylspiro[benzo[g]indol-1-ium-3,1'-cyclohexane]-2-yl)penta-2,4-dienylidene]indol-1-yl]propanoic acid |
| SMILES | C[N+]1=C(/C=C/C=C/C=C2/N(CCC(=O)O)c3ccccc3C2(C)Cc2ccccc2)C2(CCCCC2)c2ccc3ccccc3c21 |
| InChI | InChI=1S/C42H42N2O2/c1-41(30-31-16-6-3-7-17-31)34-20-12-13-21-36(34)44(29-26-39(45)46)37(41)22-8-4-9-23-38-42(27-14-5-15-28-42)35-25-24-32-18-10-11-19-33(32)40(35)43(38)2/h3-4,6-13,16-25H,5,14-15,26-30H2,1-2H3/p+1 |
| InChIKey | LNIOZPZGZIJLCH-UHFFFAOYSA-O |
| XLogP | 9.26 |
| TPSA | 43.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.82 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|