C45H47N2O6+ — CID 72569752
3-[3-benzyl-2-[5-[3-benzyl-1-(2-carboxyethyl)-5-methoxy-3-methylindol-1-ium-2-yl]penta-2,4-dienylidene]-5-methoxy-3-methylindol-1-yl]propanoic acid (PubChem CID 72569752) has the molecular formula C45H47N2O6+ and a molecular weight of 711.88 g/mol. Its IUPAC name is 3-[3-benzyl-2-[5-[3-benzyl-1-(2-carboxyethyl)-5-methoxy-3-methylindol-1-ium-2-yl]penta-2,4-dienylidene]-5-methoxy-3-methylindol-1-yl]propanoic acid.
| Compound Name | 3-[3-benzyl-2-[5-[3-benzyl-1-(2-carboxyethyl)-5-methoxy-3-methylindol-1-ium-2-yl]penta-2,4-dienylidene]-5-methoxy-3-methylindol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 72569752 |
| Molecular Formula | C45H47N2O6+ |
| Molecular Weight | 711.88 g/mol |
| Exact Mass | 711.34 |
| IUPAC Name | 3-[3-benzyl-2-[5-[3-benzyl-1-(2-carboxyethyl)-5-methoxy-3-methylindol-1-ium-2-yl]penta-2,4-dienylidene]-5-methoxy-3-methylindol-1-yl]propanoic acid |
| SMILES | COc1ccc2c(c1)C(C)(Cc1ccccc1)C(=CC=CC=CC1=[N+](CCC(=O)O)c3ccc(OC)cc3C1(C)Cc1ccccc1)N2CCC(=O)O |
| InChI | InChI=1S/C45H46N2O6/c1-44(30-32-14-8-5-9-15-32)36-28-34(52-3)20-22-38(36)46(26-24-42(48)49)40(44)18-12-7-13-19-41-45(2,31-33-16-10-6-11-17-33)37-29-35(53-4)21-23-39(37)47(41)27-25-43(50)51/h5-23,28-29H,24-27,30-31H2,1-4H3,(H-,48,49,50,51)/p+1 |
| InChIKey | XKCSBIJVHGWCET-UHFFFAOYSA-O |
| XLogP | 8.27 |
| TPSA | 99.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.88 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|