C57H59N2O4+ — CID 72526432
6-[1-benzyl-2-[5-[1-benzyl-3-(5-carboxypentyl)-1-methylbenzo[e]indol-3-ium-2-yl]penta-2,4-dienylidene]-1-methylbenzo[e]indol-3-yl]hexanoic acid (PubChem CID 72526432) has the molecular formula C57H59N2O4+ and a molecular weight of 836.11 g/mol. Its IUPAC name is 6-[1-benzyl-2-[5-[1-benzyl-3-(5-carboxypentyl)-1-methylbenzo[e]indol-3-ium-2-yl]penta-2,4-dienylidene]-1-methylbenzo[e]indol-3-yl]hexanoic acid.
| Compound Name | 6-[1-benzyl-2-[5-[1-benzyl-3-(5-carboxypentyl)-1-methylbenzo[e]indol-3-ium-2-yl]penta-2,4-dienylidene]-1-methylbenzo[e]indol-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 72526432 |
| Molecular Formula | C57H59N2O4+ |
| Molecular Weight | 836.11 g/mol |
| Exact Mass | 835.45 |
| IUPAC Name | 6-[1-benzyl-2-[5-[1-benzyl-3-(5-carboxypentyl)-1-methylbenzo[e]indol-3-ium-2-yl]penta-2,4-dienylidene]-1-methylbenzo[e]indol-3-yl]hexanoic acid |
| SMILES | CC1(Cc2ccccc2)C(=CC=CC=CC2=[N+](CCCCCC(=O)O)c3ccc4ccccc4c3C2(C)Cc2ccccc2)N(CCCCCC(=O)O)c2ccc3ccccc3c21 |
| InChI | InChI=1S/C57H58N2O4/c1-56(40-42-22-8-3-9-23-42)50(58(38-20-6-14-32-52(60)61)48-36-34-44-26-16-18-28-46(44)54(48)56)30-12-5-13-31-51-57(2,41-43-24-10-4-11-25-43)55-47-29-19-17-27-45(47)35-37-49(55)59(51)39-21-7-15-33-53(62)63/h3-5,8-13,16-19,22-31,34-37H,6-7,14-15,20-21,32-33,38-41H2,1-2H3,(H-,60,61,62,63)/p+1 |
| InChIKey | RLHBNGFXXGRIKL-UHFFFAOYSA-O |
| XLogP | 12.90 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.11 |
| LogP ≤ 5 | 12.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|