C57H55N2O6+ — CID 121460262
3-[(2Z)-3,3-dibenzyl-2-[(2E,4E)-5-[3,3-dibenzyl-1-(2-carboxyethyl)-5-methoxyindol-1-ium-2-yl]penta-2,4-dienylidene]-5-methoxyindol-1-yl]propanoic acid (PubChem CID 121460262) has the molecular formula C57H55N2O6+ and a molecular weight of 864.08 g/mol. Its IUPAC name is 3-[(2Z)-3,3-dibenzyl-2-[(2E,4E)-5-[3,3-dibenzyl-1-(2-carboxyethyl)-5-methoxyindol-1-ium-2-yl]penta-2,4-dienylidene]-5-methoxyindol-1-yl]propanoic acid.
| Compound Name | 3-[(2Z)-3,3-dibenzyl-2-[(2E,4E)-5-[3,3-dibenzyl-1-(2-carboxyethyl)-5-methoxyindol-1-ium-2-yl]penta-2,4-dienylidene]-5-methoxyindol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 121460262 |
| Molecular Formula | C57H55N2O6+ |
| Molecular Weight | 864.08 g/mol |
| Exact Mass | 863.41 |
| IUPAC Name | 3-[(2Z)-3,3-dibenzyl-2-[(2E,4E)-5-[3,3-dibenzyl-1-(2-carboxyethyl)-5-methoxyindol-1-ium-2-yl]penta-2,4-dienylidene]-5-methoxyindol-1-yl]propanoic acid |
| SMILES | COc1ccc2c(c1)C(Cc1ccccc1)(Cc1ccccc1)C(/C=C/C=C/C=C1\N(CCC(=O)O)c3ccc(OC)cc3C1(Cc1ccccc1)Cc1ccccc1)=[N+]2CCC(=O)O |
| InChI | InChI=1S/C57H54N2O6/c1-64-46-28-30-50-48(36-46)56(38-42-18-8-3-9-19-42,39-43-20-10-4-11-21-43)52(58(50)34-32-54(60)61)26-16-7-17-27-53-57(40-44-22-12-5-13-23-44,41-45-24-14-6-15-25-45)49-37-47(65-2)29-31-51(49)59(53)35-33-55(62)63/h3-31,36-37H,32-35,38-41H2,1-2H3,(H-,60,61,62,63)/p+1 |
| InChIKey | XGWCYTZLTYPEIF-UHFFFAOYSA-O |
| XLogP | 10.71 |
| TPSA | 99.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.08 |
| LogP ≤ 5 | 10.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|