C35H45N2O2+ — CID 23311992
(2E)-1,3,3-triethyl-2-[(2E,4E,6E)-7-(1-ethyl-5-methoxy-3,3-dimethylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]-5-methoxyindole (PubChem CID 23311992) has the molecular formula C35H45N2O2+ and a molecular weight of 525.76 g/mol. Its IUPAC name is (2E)-1,3,3-triethyl-2-[(2E,4E,6E)-7-(1-ethyl-5-methoxy-3,3-dimethylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]-5-methoxyindole.
| Compound Name | (2E)-1,3,3-triethyl-2-[(2E,4E,6E)-7-(1-ethyl-5-methoxy-3,3-dimethylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]-5-methoxyindole |
|---|---|
| PubChem CID | 23311992 |
| Molecular Formula | C35H45N2O2+ |
| Molecular Weight | 525.76 g/mol |
| Exact Mass | 525.35 |
| IUPAC Name | (2E)-1,3,3-triethyl-2-[(2E,4E,6E)-7-(1-ethyl-5-methoxy-3,3-dimethylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]-5-methoxyindole |
| SMILES | CCN1/C(=C/C=C/C=C/C=C/C2=[N+](CC)c3ccc(OC)cc3C2(C)C)C(CC)(CC)c2cc(OC)ccc21 |
| InChI | InChI=1S/C35H45N2O2/c1-9-35(10-2)29-25-27(39-8)21-23-31(29)37(12-4)33(35)19-17-15-13-14-16-18-32-34(5,6)28-24-26(38-7)20-22-30(28)36(32)11-3/h13-25H,9-12H2,1-8H3/q+1 |
| InChIKey | IGJYOTWILNMROZ-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 24.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.76 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|