C32H38N2O5S — CID 25120199
2-[(1E,3E,5E)-5-[5-(2-carboxyethyl)-1-ethyl-3,3-dimethylindol-2-ylidene]penta-1,3-dienyl]-1-ethyl-3,3-dimethylindol-1-ium-5-sulfonate (PubChem CID 25120199) has the molecular formula C32H38N2O5S and a molecular weight of 562.73 g/mol. Its IUPAC name is 2-[(1E,3E,5E)-5-[5-(2-carboxyethyl)-1-ethyl-3,3-dimethylindol-2-ylidene]penta-1,3-dienyl]-1-ethyl-3,3-dimethylindol-1-ium-5-sulfonate.
| Compound Name | 2-[(1E,3E,5E)-5-[5-(2-carboxyethyl)-1-ethyl-3,3-dimethylindol-2-ylidene]penta-1,3-dienyl]-1-ethyl-3,3-dimethylindol-1-ium-5-sulfonate |
|---|---|
| PubChem CID | 25120199 |
| Molecular Formula | C32H38N2O5S |
| Molecular Weight | 562.73 g/mol |
| Exact Mass | 562.25 |
| IUPAC Name | 2-[(1E,3E,5E)-5-[5-(2-carboxyethyl)-1-ethyl-3,3-dimethylindol-2-ylidene]penta-1,3-dienyl]-1-ethyl-3,3-dimethylindol-1-ium-5-sulfonate |
| SMILES | CCN1/C(=C/C=C/C=C/C2=[N+](CC)c3ccc(S(=O)(=O)[O-])cc3C2(C)C)C(C)(C)c2cc(CCC(=O)O)ccc21 |
| InChI | InChI=1S/C32H38N2O5S/c1-7-33-26-17-14-22(15-19-30(35)36)20-24(26)31(3,4)28(33)12-10-9-11-13-29-32(5,6)25-21-23(40(37,38)39)16-18-27(25)34(29)8-2/h9-14,16-18,20-21H,7-8,15,19H2,1-6H3,(H-,35,36,37,38,39) |
| InChIKey | CRMNQHAIXFAECK-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.73 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|