C31H35Cl2N2+ — CID 169309039
(2E)-5-chloro-2-[(2E,4E,6E)-7-(5-chloro-1-ethyl-3,3-dimethylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]-1-ethyl-3,3-dimethylindole (PubChem CID 169309039) has the molecular formula C31H35Cl2N2+ and a molecular weight of 506.54 g/mol. Its IUPAC name is (2E)-5-chloro-2-[(2E,4E,6E)-7-(5-chloro-1-ethyl-3,3-dimethylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]-1-ethyl-3,3-dimethylindole.
| Compound Name | (2E)-5-chloro-2-[(2E,4E,6E)-7-(5-chloro-1-ethyl-3,3-dimethylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]-1-ethyl-3,3-dimethylindole |
|---|---|
| PubChem CID | 169309039 |
| Molecular Formula | C31H35Cl2N2+ |
| Molecular Weight | 506.54 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | (2E)-5-chloro-2-[(2E,4E,6E)-7-(5-chloro-1-ethyl-3,3-dimethylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]-1-ethyl-3,3-dimethylindole |
| SMILES | CCN1/C(=C/C=C/C=C/C=C/C2=[N+](CC)c3ccc(Cl)cc3C2(C)C)C(C)(C)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C31H35Cl2N2/c1-7-34-26-18-16-22(32)20-24(26)30(3,4)28(34)14-12-10-9-11-13-15-29-31(5,6)25-21-23(33)17-19-27(25)35(29)8-2/h9-21H,7-8H2,1-6H3/q+1 |
| InChIKey | JPBIPFOPVNPZAY-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.54 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|