C37H47I2N2O2+ — CID 58703900
tert-butyl 6-[2-[(1E,3E,5Z)-5-(1-ethyl-5-iodo-3,3-dimethylindol-2-ylidene)penta-1,3-dienyl]-5-iodo-3,3-dimethylindol-1-ium-1-yl]hexanoate (PubChem CID 58703900) has the molecular formula C37H47I2N2O2+ and a molecular weight of 805.60 g/mol. Its IUPAC name is tert-butyl 6-[2-[(1E,3E,5Z)-5-(1-ethyl-5-iodo-3,3-dimethylindol-2-ylidene)penta-1,3-dienyl]-5-iodo-3,3-dimethylindol-1-ium-1-yl]hexanoate.
| Compound Name | tert-butyl 6-[2-[(1E,3E,5Z)-5-(1-ethyl-5-iodo-3,3-dimethylindol-2-ylidene)penta-1,3-dienyl]-5-iodo-3,3-dimethylindol-1-ium-1-yl]hexanoate |
|---|---|
| PubChem CID | 58703900 |
| Molecular Formula | C37H47I2N2O2+ |
| Molecular Weight | 805.60 g/mol |
| Exact Mass | 805.17 |
| IUPAC Name | tert-butyl 6-[2-[(1E,3E,5Z)-5-(1-ethyl-5-iodo-3,3-dimethylindol-2-ylidene)penta-1,3-dienyl]-5-iodo-3,3-dimethylindol-1-ium-1-yl]hexanoate |
| SMILES | CCN1/C(=C\C=C\C=C\C2=[N+](CCCCCC(=O)OC(C)(C)C)c3ccc(I)cc3C2(C)C)C(C)(C)c2cc(I)ccc21 |
| InChI | InChI=1S/C37H47I2N2O2/c1-9-40-30-21-19-26(38)24-28(30)36(5,6)32(40)16-12-10-13-17-33-37(7,8)29-25-27(39)20-22-31(29)41(33)23-15-11-14-18-34(42)43-35(2,3)4/h10,12-13,16-17,19-22,24-25H,9,11,14-15,18,23H2,1-8H3/q+1 |
| InChIKey | GIFHQJUFCOROLJ-UHFFFAOYSA-N |
| XLogP | 9.99 |
| TPSA | 32.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.60 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|