C38H51N2O+ — CID 158109355
8-[2-[5-(1-ethyl-3,3-dimethylindol-2-ylidene)penta-1,3-dienyl]-3,3,5-trimethylindol-1-ium-1-yl]-2,2-dimethyloctan-3-one (PubChem CID 158109355) has the molecular formula C38H51N2O+ and a molecular weight of 551.84 g/mol. Its IUPAC name is 8-[2-[5-(1-ethyl-3,3-dimethylindol-2-ylidene)penta-1,3-dienyl]-3,3,5-trimethylindol-1-ium-1-yl]-2,2-dimethyloctan-3-one.
| Compound Name | 8-[2-[5-(1-ethyl-3,3-dimethylindol-2-ylidene)penta-1,3-dienyl]-3,3,5-trimethylindol-1-ium-1-yl]-2,2-dimethyloctan-3-one |
|---|---|
| PubChem CID | 158109355 |
| Molecular Formula | C38H51N2O+ |
| Molecular Weight | 551.84 g/mol |
| Exact Mass | 551.40 |
| IUPAC Name | 8-[2-[5-(1-ethyl-3,3-dimethylindol-2-ylidene)penta-1,3-dienyl]-3,3,5-trimethylindol-1-ium-1-yl]-2,2-dimethyloctan-3-one |
| SMILES | CCN1C(=CC=CC=CC2=[N+](CCCCCC(=O)C(C)(C)C)c3ccc(C)cc3C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C38H51N2O/c1-10-39-31-20-17-16-19-29(31)37(6,7)33(39)21-13-11-14-22-34-38(8,9)30-27-28(2)24-25-32(30)40(34)26-18-12-15-23-35(41)36(3,4)5/h11,13-14,16-17,19-22,24-25,27H,10,12,15,18,23,26H2,1-9H3/q+1 |
| InChIKey | XICNYMUUBDKIET-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 23.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.84 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|