C40H49Cl2N6O4S+ — CID 160508843
1-[9-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-8-oxononyl]-2-[5-(1-ethyl-3,3,5-trimethylindol-2-ylidene)penta-1,3-dienyl]-3,3-dimethylindol-1-ium-5-sulfonic acid (PubChem CID 160508843) has the molecular formula C40H49Cl2N6O4S+ and a molecular weight of 780.84 g/mol. Its IUPAC name is 1-[9-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-8-oxononyl]-2-[5-(1-ethyl-3,3,5-trimethylindol-2-ylidene)penta-1,3-dienyl]-3,3-dimethylindol-1-ium-5-sulfonic acid.
| Compound Name | 1-[9-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-8-oxononyl]-2-[5-(1-ethyl-3,3,5-trimethylindol-2-ylidene)penta-1,3-dienyl]-3,3-dimethylindol-1-ium-5-sulfonic acid |
|---|---|
| PubChem CID | 160508843 |
| Molecular Formula | C40H49Cl2N6O4S+ |
| Molecular Weight | 780.84 g/mol |
| Exact Mass | 779.29 |
| IUPAC Name | 1-[9-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-8-oxononyl]-2-[5-(1-ethyl-3,3,5-trimethylindol-2-ylidene)penta-1,3-dienyl]-3,3-dimethylindol-1-ium-5-sulfonic acid |
| SMILES | CCN1C(=CC=CC=CC2=[N+](CCCCCCCC(=O)CNc3nc(Cl)nc(Cl)n3)c3ccc(S(=O)(=O)O)cc3C2(C)C)C(C)(C)c2cc(C)ccc21 |
| InChI | InChI=1S/C40H48Cl2N6O4S/c1-7-47-32-21-19-27(2)24-30(32)39(3,4)34(47)17-13-11-14-18-35-40(5,6)31-25-29(53(50,51)52)20-22-33(31)48(35)23-15-10-8-9-12-16-28(49)26-43-38-45-36(41)44-37(42)46-38/h11,13-14,17-22,24-25H,7-10,12,15-16,23,26H2,1-6H3,(H-,43,44,45,46,50,51,52)/p+1 |
| InChIKey | QSTUPVRLQGYQBB-UHFFFAOYSA-O |
| XLogP | 8.95 |
| TPSA | 128.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.84 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|