C43H55N2O4S+ — CID 157197572
2-[5-[1-[8-[(2R)-2-bicyclo[2.2.1]hept-5-enyl]-6-oxooctyl]-3,3,5-trimethylindol-1-ium-2-yl]penta-2,4-dienylidene]-1-ethyl-3,3-dimethylindole-5-sulfonic acid (PubChem CID 157197572) has the molecular formula C43H55N2O4S+ and a molecular weight of 695.99 g/mol. Its IUPAC name is 2-[5-[1-[8-[(2R)-2-bicyclo[2.2.1]hept-5-enyl]-6-oxooctyl]-3,3,5-trimethylindol-1-ium-2-yl]penta-2,4-dienylidene]-1-ethyl-3,3-dimethylindole-5-sulfonic acid.
| Compound Name | 2-[5-[1-[8-[(2R)-2-bicyclo[2.2.1]hept-5-enyl]-6-oxooctyl]-3,3,5-trimethylindol-1-ium-2-yl]penta-2,4-dienylidene]-1-ethyl-3,3-dimethylindole-5-sulfonic acid |
|---|---|
| PubChem CID | 157197572 |
| Molecular Formula | C43H55N2O4S+ |
| Molecular Weight | 695.99 g/mol |
| Exact Mass | 695.39 |
| IUPAC Name | 2-[5-[1-[8-[(2R)-2-bicyclo[2.2.1]hept-5-enyl]-6-oxooctyl]-3,3,5-trimethylindol-1-ium-2-yl]penta-2,4-dienylidene]-1-ethyl-3,3-dimethylindole-5-sulfonic acid |
| SMILES | CCN1C(=CC=CC=CC2=[N+](CCCCCC(=O)CC[C@@H]3CC4C=CC3C4)c3ccc(C)cc3C2(C)C)C(C)(C)c2cc(S(=O)(=O)O)ccc21 |
| InChI | InChI=1S/C43H54N2O4S/c1-7-44-38-24-22-35(50(47,48)49)29-37(38)43(5,6)40(44)15-11-8-12-16-41-42(3,4)36-26-30(2)17-23-39(36)45(41)25-13-9-10-14-34(46)21-20-33-28-31-18-19-32(33)27-31/h8,11-12,15-19,22-24,26,29,31-33H,7,9-10,13-14,20-21,25,27-28H2,1-6H3/p+1/t31?,32?,33-/m1/s1 |
| InChIKey | AQKRZZQBXBOQPH-OXLCSVRNSA-O |
| XLogP | 9.55 |
| TPSA | 77.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.99 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|