C41H53N2O4+ — CID 175117514
6-[2-[7-[1-(5-carboxypentyl)-3,3,5-trimethylindol-1-ium-2-yl]hepta-2,4,6-trienylidene]-3,3,5-trimethylindol-1-yl]hexanoic acid (PubChem CID 175117514) has the molecular formula C41H53N2O4+ and a molecular weight of 637.89 g/mol. Its IUPAC name is 6-[2-[7-[1-(5-carboxypentyl)-3,3,5-trimethylindol-1-ium-2-yl]hepta-2,4,6-trienylidene]-3,3,5-trimethylindol-1-yl]hexanoic acid.
| Compound Name | 6-[2-[7-[1-(5-carboxypentyl)-3,3,5-trimethylindol-1-ium-2-yl]hepta-2,4,6-trienylidene]-3,3,5-trimethylindol-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 175117514 |
| Molecular Formula | C41H53N2O4+ |
| Molecular Weight | 637.89 g/mol |
| Exact Mass | 637.40 |
| IUPAC Name | 6-[2-[7-[1-(5-carboxypentyl)-3,3,5-trimethylindol-1-ium-2-yl]hepta-2,4,6-trienylidene]-3,3,5-trimethylindol-1-yl]hexanoic acid |
| SMILES | Cc1ccc2c(c1)C(C)(C)C(=CC=CC=CC=CC1=[N+](CCCCCC(=O)O)c3ccc(C)cc3C1(C)C)N2CCCCCC(=O)O |
| InChI | InChI=1S/C41H52N2O4/c1-30-22-24-34-32(28-30)40(3,4)36(42(34)26-16-10-14-20-38(44)45)18-12-8-7-9-13-19-37-41(5,6)33-29-31(2)23-25-35(33)43(37)27-17-11-15-21-39(46)47/h7-9,12-13,18-19,22-25,28-29H,10-11,14-17,20-21,26-27H2,1-6H3,(H-,44,45,46,47)/p+1 |
| InChIKey | GYLYCQLABUZJJK-UHFFFAOYSA-O |
| XLogP | 9.32 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.89 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|