C38H52N3O9S2+ — CID 159288319
6-[3,3-dimethyl-5-sulfo-2-[(E,3E)-3-[3,3,5-trimethyl-1-[5-oxo-5-(2-sulfopropylamino)pentyl]indol-2-ylidene]prop-1-enyl]indol-1-ium-1-yl]hexanoic acid (PubChem CID 159288319) has the molecular formula C38H52N3O9S2+ and a molecular weight of 758.98 g/mol. Its IUPAC name is 6-[3,3-dimethyl-5-sulfo-2-[(E,3E)-3-[3,3,5-trimethyl-1-[5-oxo-5-(2-sulfopropylamino)pentyl]indol-2-ylidene]prop-1-enyl]indol-1-ium-1-yl]hexanoic acid.
| Compound Name | 6-[3,3-dimethyl-5-sulfo-2-[(E,3E)-3-[3,3,5-trimethyl-1-[5-oxo-5-(2-sulfopropylamino)pentyl]indol-2-ylidene]prop-1-enyl]indol-1-ium-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 159288319 |
| Molecular Formula | C38H52N3O9S2+ |
| Molecular Weight | 758.98 g/mol |
| Exact Mass | 758.31 |
| IUPAC Name | 6-[3,3-dimethyl-5-sulfo-2-[(E,3E)-3-[3,3,5-trimethyl-1-[5-oxo-5-(2-sulfopropylamino)pentyl]indol-2-ylidene]prop-1-enyl]indol-1-ium-1-yl]hexanoic acid |
| SMILES | Cc1ccc2c(c1)C(C)(C)/C(=C\C=C\C1=[N+](CCCCCC(=O)O)c3ccc(S(=O)(=O)O)cc3C1(C)C)N2CCCCC(=O)NCC(C)S(=O)(=O)O |
| InChI | InChI=1S/C38H51N3O9S2/c1-26-17-19-31-29(23-26)37(3,4)33(41(31)22-11-9-15-35(42)39-25-27(2)51(45,46)47)13-12-14-34-38(5,6)30-24-28(52(48,49)50)18-20-32(30)40(34)21-10-7-8-16-36(43)44/h12-14,17-20,23-24,27H,7-11,15-16,21-22,25H2,1-6H3,(H3-,39,42,43,44,45,46,47,48,49,50)/p+1 |
| InChIKey | NJRNKVRPPPSJLD-UHFFFAOYSA-O |
| XLogP | 6.06 |
| TPSA | 181.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.98 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|