C36H48N3O9S4+ — CID 76600485
3-[2-[6-[2-[3-(1-ethyl-3,3-dimethyl-5-sulfoindol-2-ylidene)prop-1-enyl]-3,3-dimethyl-5-sulfoindol-1-ium-1-yl]hexanoylamino]ethyldisulfanyl]propanoic acid (PubChem CID 76600485) has the molecular formula C36H48N3O9S4+ and a molecular weight of 795.06 g/mol. Its IUPAC name is 3-[2-[6-[2-[3-(1-ethyl-3,3-dimethyl-5-sulfoindol-2-ylidene)prop-1-enyl]-3,3-dimethyl-5-sulfoindol-1-ium-1-yl]hexanoylamino]ethyldisulfanyl]propanoic acid.
| Compound Name | 3-[2-[6-[2-[3-(1-ethyl-3,3-dimethyl-5-sulfoindol-2-ylidene)prop-1-enyl]-3,3-dimethyl-5-sulfoindol-1-ium-1-yl]hexanoylamino]ethyldisulfanyl]propanoic acid |
|---|---|
| PubChem CID | 76600485 |
| Molecular Formula | C36H48N3O9S4+ |
| Molecular Weight | 795.06 g/mol |
| Exact Mass | 794.23 |
| IUPAC Name | 3-[2-[6-[2-[3-(1-ethyl-3,3-dimethyl-5-sulfoindol-2-ylidene)prop-1-enyl]-3,3-dimethyl-5-sulfoindol-1-ium-1-yl]hexanoylamino]ethyldisulfanyl]propanoic acid |
| SMILES | CCN1C(=CC=CC2=[N+](CCCCCC(=O)NCCSSCCC(=O)O)c3ccc(S(=O)(=O)O)cc3C2(C)C)C(C)(C)c2cc(S(=O)(=O)O)ccc21 |
| InChI | InChI=1S/C36H47N3O9S4/c1-6-38-29-16-14-25(51(43,44)45)23-27(29)35(2,3)31(38)11-10-12-32-36(4,5)28-24-26(52(46,47)48)15-17-30(28)39(32)20-9-7-8-13-33(40)37-19-22-50-49-21-18-34(41)42/h10-12,14-17,23-24H,6-9,13,18-22H2,1-5H3,(H3-,37,40,41,42,43,44,45,46,47,48)/p+1 |
| InChIKey | VAJDKYXOHFTJOZ-UHFFFAOYSA-O |
| XLogP | 6.35 |
| TPSA | 181.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.06 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|