C37H45N4O9S2+ — CID 164886380
2-[3-[1-[6-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-6-oxohexyl]-3,3-dimethyl-5-sulfoindol-1-ium-2-yl]prop-2-enylidene]-1-ethyl-3,3-dimethylindole-5-sulfonic acid (PubChem CID 164886380) has the molecular formula C37H45N4O9S2+ and a molecular weight of 753.92 g/mol. Its IUPAC name is 2-[3-[1-[6-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-6-oxohexyl]-3,3-dimethyl-5-sulfoindol-1-ium-2-yl]prop-2-enylidene]-1-ethyl-3,3-dimethylindole-5-sulfonic acid.
| Compound Name | 2-[3-[1-[6-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-6-oxohexyl]-3,3-dimethyl-5-sulfoindol-1-ium-2-yl]prop-2-enylidene]-1-ethyl-3,3-dimethylindole-5-sulfonic acid |
|---|---|
| PubChem CID | 164886380 |
| Molecular Formula | C37H45N4O9S2+ |
| Molecular Weight | 753.92 g/mol |
| Exact Mass | 753.26 |
| IUPAC Name | 2-[3-[1-[6-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-6-oxohexyl]-3,3-dimethyl-5-sulfoindol-1-ium-2-yl]prop-2-enylidene]-1-ethyl-3,3-dimethylindole-5-sulfonic acid |
| SMILES | CCN1C(=CC=CC2=[N+](CCCCCC(=O)NCCN3C(=O)C=CC3=O)c3ccc(S(=O)(=O)O)cc3C2(C)C)C(C)(C)c2cc(S(=O)(=O)O)ccc21 |
| InChI | InChI=1S/C37H44N4O9S2/c1-6-39-29-16-14-25(51(45,46)47)23-27(29)36(2,3)31(39)11-10-12-32-37(4,5)28-24-26(52(48,49)50)15-17-30(28)40(32)21-9-7-8-13-33(42)38-20-22-41-34(43)18-19-35(41)44/h10-12,14-19,23-24H,6-9,13,20-22H2,1-5H3,(H2-,38,42,45,46,47,48,49,50)/p+1 |
| InChIKey | UBMGLQQVDUHGLY-UHFFFAOYSA-O |
| XLogP | 4.42 |
| TPSA | 181.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.92 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|