C33H40N2O5S — CID 162044711
1-(5-carboxypentyl)-3,3-dimethyl-2-[5-(1,3,3,5-tetramethylindol-1-ium-2-yl)penta-2,4-dienylidene]indole-5-sulfonate (PubChem CID 162044711) has the molecular formula C33H40N2O5S and a molecular weight of 576.76 g/mol. Its IUPAC name is 1-(5-carboxypentyl)-3,3-dimethyl-2-[5-(1,3,3,5-tetramethylindol-1-ium-2-yl)penta-2,4-dienylidene]indole-5-sulfonate.
| Compound Name | 1-(5-carboxypentyl)-3,3-dimethyl-2-[5-(1,3,3,5-tetramethylindol-1-ium-2-yl)penta-2,4-dienylidene]indole-5-sulfonate |
|---|---|
| PubChem CID | 162044711 |
| Molecular Formula | C33H40N2O5S |
| Molecular Weight | 576.76 g/mol |
| Exact Mass | 576.27 |
| IUPAC Name | 1-(5-carboxypentyl)-3,3-dimethyl-2-[5-(1,3,3,5-tetramethylindol-1-ium-2-yl)penta-2,4-dienylidene]indole-5-sulfonate |
| SMILES | Cc1ccc2c(c1)C(C)(C)C(C=CC=CC=C1N(CCCCCC(=O)O)c3ccc(S(=O)(=O)[O-])cc3C1(C)C)=[N+]2C |
| InChI | InChI=1S/C33H40N2O5S/c1-23-16-18-27-25(21-23)32(2,3)29(34(27)6)13-9-7-10-14-30-33(4,5)26-22-24(41(38,39)40)17-19-28(26)35(30)20-12-8-11-15-31(36)37/h7,9-10,13-14,16-19,21-22H,8,11-12,15,20H2,1-6H3,(H-,36,37,38,39,40) |
| InChIKey | XOPNLOJVQRKQIY-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.76 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|