C43H58N2O5S — CID 167670631
1-(6,13-dioxopentadecyl)-2-[(1E,3E,5Z)-5-(1-ethyl-3,3,5-trimethylindol-2-ylidene)penta-1,3-dienyl]-3,3-dimethylindol-1-ium-5-sulfonate (PubChem CID 167670631) has the molecular formula C43H58N2O5S and a molecular weight of 715.01 g/mol. Its IUPAC name is 1-(6,13-dioxopentadecyl)-2-[(1E,3E,5Z)-5-(1-ethyl-3,3,5-trimethylindol-2-ylidene)penta-1,3-dienyl]-3,3-dimethylindol-1-ium-5-sulfonate.
| Compound Name | 1-(6,13-dioxopentadecyl)-2-[(1E,3E,5Z)-5-(1-ethyl-3,3,5-trimethylindol-2-ylidene)penta-1,3-dienyl]-3,3-dimethylindol-1-ium-5-sulfonate |
|---|---|
| PubChem CID | 167670631 |
| Molecular Formula | C43H58N2O5S |
| Molecular Weight | 715.01 g/mol |
| Exact Mass | 714.41 |
| IUPAC Name | 1-(6,13-dioxopentadecyl)-2-[(1E,3E,5Z)-5-(1-ethyl-3,3,5-trimethylindol-2-ylidene)penta-1,3-dienyl]-3,3-dimethylindol-1-ium-5-sulfonate |
| SMILES | CCC(=O)CCCCCCC(=O)CCCCC[N+]1=C(/C=C/C=C/C=C2\N(CC)c3ccc(C)cc3C2(C)C)C(C)(C)c2cc(S(=O)(=O)[O-])ccc21 |
| InChI | InChI=1S/C43H58N2O5S/c1-8-33(46)20-14-10-11-15-21-34(47)22-16-13-19-29-45-39-28-26-35(51(48,49)50)31-37(39)43(6,7)41(45)24-18-12-17-23-40-42(4,5)36-30-32(3)25-27-38(36)44(40)9-2/h12,17-18,23-28,30-31H,8-11,13-16,19-22,29H2,1-7H3 |
| InChIKey | UBEQEBYLJKOEPL-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.01 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|