C38H52N3O6S+ — CID 147317846
2-[3-(1-ethyl-3,3,5-trimethylindol-2-ylidene)prop-1-enyl]-3,3-dimethyl-1-[7-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxoheptyl]indol-1-ium-5-sulfonic acid (PubChem CID 147317846) has the molecular formula C38H52N3O6S+ and a molecular weight of 678.92 g/mol. Its IUPAC name is 2-[3-(1-ethyl-3,3,5-trimethylindol-2-ylidene)prop-1-enyl]-3,3-dimethyl-1-[7-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxoheptyl]indol-1-ium-5-sulfonic acid.
| Compound Name | 2-[3-(1-ethyl-3,3,5-trimethylindol-2-ylidene)prop-1-enyl]-3,3-dimethyl-1-[7-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxoheptyl]indol-1-ium-5-sulfonic acid |
|---|---|
| PubChem CID | 147317846 |
| Molecular Formula | C38H52N3O6S+ |
| Molecular Weight | 678.92 g/mol |
| Exact Mass | 678.36 |
| IUPAC Name | 2-[3-(1-ethyl-3,3,5-trimethylindol-2-ylidene)prop-1-enyl]-3,3-dimethyl-1-[7-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxoheptyl]indol-1-ium-5-sulfonic acid |
| SMILES | CCN1C(=CC=CC2=[N+](CCCCCC(=O)CNC(=O)OC(C)(C)C)c3ccc(S(=O)(=O)O)cc3C2(C)C)C(C)(C)c2cc(C)ccc21 |
| InChI | InChI=1S/C38H51N3O6S/c1-10-40-31-20-18-26(2)23-29(31)37(6,7)33(40)16-14-17-34-38(8,9)30-24-28(48(44,45)46)19-21-32(30)41(34)22-13-11-12-15-27(42)25-39-35(43)47-36(3,4)5/h14,16-21,23-24H,10-13,15,22,25H2,1-9H3,(H-,39,43,44,45,46)/p+1 |
| InChIKey | CZFJYLKNQUAHDR-UHFFFAOYSA-O |
| XLogP | 7.53 |
| TPSA | 116.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.92 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|