C39H51N3O6S2 — CID 172741776
2-[5-[1-[8-(2-ethenylsulfonylethylamino)-8-oxooctyl]-3,3-dimethylindol-1-ium-2-yl]penta-2,4-dienylidene]-1-ethyl-3,3-dimethylindole-5-sulfonate (PubChem CID 172741776) has the molecular formula C39H51N3O6S2 and a molecular weight of 721.99 g/mol. Its IUPAC name is 2-[5-[1-[8-(2-ethenylsulfonylethylamino)-8-oxooctyl]-3,3-dimethylindol-1-ium-2-yl]penta-2,4-dienylidene]-1-ethyl-3,3-dimethylindole-5-sulfonate.
| Compound Name | 2-[5-[1-[8-(2-ethenylsulfonylethylamino)-8-oxooctyl]-3,3-dimethylindol-1-ium-2-yl]penta-2,4-dienylidene]-1-ethyl-3,3-dimethylindole-5-sulfonate |
|---|---|
| PubChem CID | 172741776 |
| Molecular Formula | C39H51N3O6S2 |
| Molecular Weight | 721.99 g/mol |
| Exact Mass | 721.32 |
| IUPAC Name | 2-[5-[1-[8-(2-ethenylsulfonylethylamino)-8-oxooctyl]-3,3-dimethylindol-1-ium-2-yl]penta-2,4-dienylidene]-1-ethyl-3,3-dimethylindole-5-sulfonate |
| SMILES | C=CS(=O)(=O)CCNC(=O)CCCCCCC[N+]1=C(C=CC=CC=C2N(CC)c3ccc(S(=O)(=O)[O-])cc3C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C39H51N3O6S2/c1-7-41-34-25-24-30(50(46,47)48)29-32(34)39(5,6)35(41)21-13-12-14-22-36-38(3,4)31-19-16-17-20-33(31)42(36)27-18-11-9-10-15-23-37(43)40-26-28-49(44,45)8-2/h8,12-14,16-17,19-22,24-25,29H,2,7,9-11,15,18,23,26-28H2,1,3-6H3,(H-,40,43,46,47,48) |
| InChIKey | JEQOJXWGSYWIGD-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.99 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|