C35H46N3O+ — CID 59027358
N-ethyl-6-[2-[(1E,3E,5E)-5-(1-ethyl-3,3-dimethylindol-2-ylidene)penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]hexanamide (PubChem CID 59027358) has the molecular formula C35H46N3O+ and a molecular weight of 524.77 g/mol. Its IUPAC name is N-ethyl-6-[2-[(1E,3E,5E)-5-(1-ethyl-3,3-dimethylindol-2-ylidene)penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]hexanamide.
| Compound Name | N-ethyl-6-[2-[(1E,3E,5E)-5-(1-ethyl-3,3-dimethylindol-2-ylidene)penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]hexanamide |
|---|---|
| PubChem CID | 59027358 |
| Molecular Formula | C35H46N3O+ |
| Molecular Weight | 524.77 g/mol |
| Exact Mass | 524.36 |
| IUPAC Name | N-ethyl-6-[2-[(1E,3E,5E)-5-(1-ethyl-3,3-dimethylindol-2-ylidene)penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]hexanamide |
| SMILES | CCNC(=O)CCCCC[N+]1=C(/C=C/C=C/C=C2/N(CC)c3ccccc3C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C35H45N3O/c1-7-36-33(39)25-13-10-18-26-38-30-22-17-15-20-28(30)35(5,6)32(38)24-12-9-11-23-31-34(3,4)27-19-14-16-21-29(27)37(31)8-2/h9,11-12,14-17,19-24H,7-8,10,13,18,25-26H2,1-6H3/p+1 |
| InChIKey | KNKVDGVODIYHFK-UHFFFAOYSA-O |
| XLogP | 7.57 |
| TPSA | 35.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.77 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|