C36H53N5O+2 — CID 59875182
3-aminopropyl-[3-[3-[2-[(E,3E)-3-(1-ethyl-3,3-dimethylindol-2-ylidene)prop-1-enyl]-3,3-dimethylindol-1-ium-1-yl]propanoylamino]propyl]-dimethylazanium (PubChem CID 59875182) has the molecular formula C36H53N5O+2 and a molecular weight of 571.85 g/mol. Its IUPAC name is 3-aminopropyl-[3-[3-[2-[(E,3E)-3-(1-ethyl-3,3-dimethylindol-2-ylidene)prop-1-enyl]-3,3-dimethylindol-1-ium-1-yl]propanoylamino]propyl]-dimethylazanium.
| Compound Name | 3-aminopropyl-[3-[3-[2-[(E,3E)-3-(1-ethyl-3,3-dimethylindol-2-ylidene)prop-1-enyl]-3,3-dimethylindol-1-ium-1-yl]propanoylamino]propyl]-dimethylazanium |
|---|---|
| PubChem CID | 59875182 |
| Molecular Formula | C36H53N5O+2 |
| Molecular Weight | 571.85 g/mol |
| Exact Mass | 571.42 |
| IUPAC Name | 3-aminopropyl-[3-[3-[2-[(E,3E)-3-(1-ethyl-3,3-dimethylindol-2-ylidene)prop-1-enyl]-3,3-dimethylindol-1-ium-1-yl]propanoylamino]propyl]-dimethylazanium |
| SMILES | CCN1/C(=C/C=C/C2=[N+](CCC(=O)NCCC[N+](C)(C)CCCN)c3ccccc3C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C36H52N5O/c1-8-39-30-18-11-9-16-28(30)35(2,3)32(39)20-13-21-33-36(4,5)29-17-10-12-19-31(29)40(33)25-22-34(42)38-24-15-27-41(6,7)26-14-23-37/h9-13,16-21H,8,14-15,22-27,37H2,1-7H3/q+1/p+1 |
| InChIKey | LRNNDSFYTLNYIS-UHFFFAOYSA-O |
| XLogP | 5.64 |
| TPSA | 61.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.85 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|