C36H50N3O5P — CID 76798915
2-[2-[6-[2-[3-(1-ethyl-3,3-dimethylindol-2-ylidene)prop-1-enyl]-3,3-dimethylindol-1-ium-1-yl]hexanoylamino]ethoxy]ethoxy-methylphosphinate (PubChem CID 76798915) has the molecular formula C36H50N3O5P and a molecular weight of 635.79 g/mol. Its IUPAC name is 2-[2-[6-[2-[3-(1-ethyl-3,3-dimethylindol-2-ylidene)prop-1-enyl]-3,3-dimethylindol-1-ium-1-yl]hexanoylamino]ethoxy]ethoxy-methylphosphinate.
| Compound Name | 2-[2-[6-[2-[3-(1-ethyl-3,3-dimethylindol-2-ylidene)prop-1-enyl]-3,3-dimethylindol-1-ium-1-yl]hexanoylamino]ethoxy]ethoxy-methylphosphinate |
|---|---|
| PubChem CID | 76798915 |
| Molecular Formula | C36H50N3O5P |
| Molecular Weight | 635.79 g/mol |
| Exact Mass | 635.35 |
| IUPAC Name | 2-[2-[6-[2-[3-(1-ethyl-3,3-dimethylindol-2-ylidene)prop-1-enyl]-3,3-dimethylindol-1-ium-1-yl]hexanoylamino]ethoxy]ethoxy-methylphosphinate |
| SMILES | CCN1C(=CC=CC2=[N+](CCCCCC(=O)NCCOCCOP(C)(=O)[O-])c3ccccc3C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C36H50N3O5P/c1-7-38-30-18-12-10-16-28(30)35(2,3)32(38)20-15-21-33-36(4,5)29-17-11-13-19-31(29)39(33)24-14-8-9-22-34(40)37-23-25-43-26-27-44-45(6,41)42/h10-13,15-21H,7-9,14,22-27H2,1-6H3,(H-,37,40,41,42) |
| InChIKey | JEIRSYKDKPDWOZ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.79 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|