C32H42N3+ — CID 122534708
(E,6E)-4-[(E)-2-(1-ethyl-3,3-dimethylindol-1-ium-2-yl)ethenyl]-6-(1-ethyl-3,3-dimethylindol-2-ylidene)hex-4-en-1-amine (PubChem CID 122534708) has the molecular formula C32H42N3+ and a molecular weight of 468.71 g/mol. Its IUPAC name is (E,6E)-4-[(E)-2-(1-ethyl-3,3-dimethylindol-1-ium-2-yl)ethenyl]-6-(1-ethyl-3,3-dimethylindol-2-ylidene)hex-4-en-1-amine.
| Compound Name | (E,6E)-4-[(E)-2-(1-ethyl-3,3-dimethylindol-1-ium-2-yl)ethenyl]-6-(1-ethyl-3,3-dimethylindol-2-ylidene)hex-4-en-1-amine |
|---|---|
| PubChem CID | 122534708 |
| Molecular Formula | C32H42N3+ |
| Molecular Weight | 468.71 g/mol |
| Exact Mass | 468.34 |
| IUPAC Name | (E,6E)-4-[(E)-2-(1-ethyl-3,3-dimethylindol-1-ium-2-yl)ethenyl]-6-(1-ethyl-3,3-dimethylindol-2-ylidene)hex-4-en-1-amine |
| SMILES | CCN1/C(=C/C=C(/C=C/C2=[N+](CC)c3ccccc3C2(C)C)CCCN)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C32H42N3/c1-7-34-27-17-11-9-15-25(27)31(3,4)29(34)21-19-24(14-13-23-33)20-22-30-32(5,6)26-16-10-12-18-28(26)35(30)8-2/h9-12,15-22H,7-8,13-14,23,33H2,1-6H3/q+1 |
| InChIKey | DPSIXNMONJYLEU-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 32.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.71 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|