C30H37N2O+ — CID 57351960
4-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-6-(1,3,3-trimethylindol-2-ylidene)hex-4-en-1-ol (PubChem CID 57351960) has the molecular formula C30H37N2O+ and a molecular weight of 441.64 g/mol. Its IUPAC name is 4-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-6-(1,3,3-trimethylindol-2-ylidene)hex-4-en-1-ol.
| Compound Name | 4-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-6-(1,3,3-trimethylindol-2-ylidene)hex-4-en-1-ol |
|---|---|
| PubChem CID | 57351960 |
| Molecular Formula | C30H37N2O+ |
| Molecular Weight | 441.64 g/mol |
| Exact Mass | 441.29 |
| IUPAC Name | 4-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-6-(1,3,3-trimethylindol-2-ylidene)hex-4-en-1-ol |
| SMILES | CN1C(=CC=C(C=CC2=[N+](C)c3ccccc3C2(C)C)CCCO)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C30H37N2O/c1-29(2)23-13-7-9-15-25(23)31(5)27(29)19-17-22(12-11-21-33)18-20-28-30(3,4)24-14-8-10-16-26(24)32(28)6/h7-10,13-20,33H,11-12,21H2,1-6H3/q+1 |
| InChIKey | NPAAZGYPFMYJRB-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 26.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.64 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|