C38H41BF4N2O — CID 66523814
(E,6E)-4-[(E)-2-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)ethenyl]-6-(1,1,3-trimethylbenzo[e]indol-2-ylidene)hex-4-en-1-ol tetrafluoroborate (PubChem CID 66523814) has the molecular formula C38H41BF4N2O and a molecular weight of 628.56 g/mol. Its IUPAC name is (E,6E)-4-[(E)-2-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)ethenyl]-6-(1,1,3-trimethylbenzo[e]indol-2-ylidene)hex-4-en-1-ol tetrafluoroborate.
| Compound Name | (E,6E)-4-[(E)-2-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)ethenyl]-6-(1,1,3-trimethylbenzo[e]indol-2-ylidene)hex-4-en-1-ol tetrafluoroborate |
|---|---|
| PubChem CID | 66523814 |
| Molecular Formula | C38H41BF4N2O |
| Molecular Weight | 628.56 g/mol |
| Exact Mass | 628.32 |
| IUPAC Name | (E,6E)-4-[(E)-2-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)ethenyl]-6-(1,1,3-trimethylbenzo[e]indol-2-ylidene)hex-4-en-1-ol tetrafluoroborate |
| SMILES | CN1/C(=C/C=C(/C=C/C2=[N+](C)c3ccc4ccccc4c3C2(C)C)CCCO)C(C)(C)c2c1ccc1ccccc21.F[B-](F)(F)F |
| InChI | InChI=1S/C38H41N2O.BF4/c1-37(2)33(39(5)31-21-19-27-13-7-9-15-29(27)35(31)37)23-17-26(12-11-25-41)18-24-34-38(3,4)36-30-16-10-8-14-28(30)20-22-32(36)40(34)6;2-1(3,4)5/h7-10,13-24,41H,11-12,25H2,1-6H3;/q+1;-1 |
| InChIKey | SJGYHASZDHQTJM-UHFFFAOYSA-N |
| XLogP | 9.87 |
| TPSA | 26.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.56 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|