C41H39N2+ — CID 57352424
1,1,3-trimethyl-2-[3-phenyl-5-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)penta-2,4-dienylidene]benzo[e]indole (PubChem CID 57352424) has the molecular formula C41H39N2+ and a molecular weight of 559.78 g/mol. Its IUPAC name is 1,1,3-trimethyl-2-[3-phenyl-5-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)penta-2,4-dienylidene]benzo[e]indole.
| Compound Name | 1,1,3-trimethyl-2-[3-phenyl-5-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)penta-2,4-dienylidene]benzo[e]indole |
|---|---|
| PubChem CID | 57352424 |
| Molecular Formula | C41H39N2+ |
| Molecular Weight | 559.78 g/mol |
| Exact Mass | 559.31 |
| IUPAC Name | 1,1,3-trimethyl-2-[3-phenyl-5-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)penta-2,4-dienylidene]benzo[e]indole |
| SMILES | CN1C(=CC=C(C=CC2=[N+](C)c3ccc4ccccc4c3C2(C)C)c2ccccc2)C(C)(C)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C41H39N2/c1-40(2)36(42(5)34-24-20-30-16-10-12-18-32(30)38(34)40)26-22-29(28-14-8-7-9-15-28)23-27-37-41(3,4)39-33-19-13-11-17-31(33)21-25-35(39)43(37)6/h7-27H,1-6H3/q+1 |
| InChIKey | VLUBFNGAKZNRFN-UHFFFAOYSA-N |
| XLogP | 9.95 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.78 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|