C39H37Br2N2+ — CID 76785060
2-[4,6-dibromo-9-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)nona-2,4,6,8-tetraenylidene]-1,1,3-trimethylbenzo[e]indole (PubChem CID 76785060) has the molecular formula C39H37Br2N2+ and a molecular weight of 693.55 g/mol. Its IUPAC name is 2-[4,6-dibromo-9-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)nona-2,4,6,8-tetraenylidene]-1,1,3-trimethylbenzo[e]indole.
| Compound Name | 2-[4,6-dibromo-9-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)nona-2,4,6,8-tetraenylidene]-1,1,3-trimethylbenzo[e]indole |
|---|---|
| PubChem CID | 76785060 |
| Molecular Formula | C39H37Br2N2+ |
| Molecular Weight | 693.55 g/mol |
| Exact Mass | 691.13 |
| IUPAC Name | 2-[4,6-dibromo-9-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)nona-2,4,6,8-tetraenylidene]-1,1,3-trimethylbenzo[e]indole |
| SMILES | CN1C(=CC=CC(Br)=CC(Br)=CC=CC2=[N+](C)c3ccc4ccccc4c3C2(C)C)C(C)(C)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C39H37Br2N2/c1-38(2)34(42(5)32-23-21-26-13-7-9-17-30(26)36(32)38)19-11-15-28(40)25-29(41)16-12-20-35-39(3,4)37-31-18-10-8-14-27(31)22-24-33(37)43(35)6/h7-25H,1-6H3/q+1 |
| InChIKey | HGKNDRPARFONMI-UHFFFAOYSA-N |
| XLogP | 10.98 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.55 |
| LogP ≤ 5 | 10.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|