C35H37N2+ — CID 59867161
(2E)-1,1,3,8-tetramethyl-2-[(E)-3-(1,1,3,8-tetramethylbenzo[e]indol-3-ium-2-yl)prop-2-enylidene]benzo[e]indole (PubChem CID 59867161) has the molecular formula C35H37N2+ and a molecular weight of 485.70 g/mol. Its IUPAC name is (2E)-1,1,3,8-tetramethyl-2-[(E)-3-(1,1,3,8-tetramethylbenzo[e]indol-3-ium-2-yl)prop-2-enylidene]benzo[e]indole.
| Compound Name | (2E)-1,1,3,8-tetramethyl-2-[(E)-3-(1,1,3,8-tetramethylbenzo[e]indol-3-ium-2-yl)prop-2-enylidene]benzo[e]indole |
|---|---|
| PubChem CID | 59867161 |
| Molecular Formula | C35H37N2+ |
| Molecular Weight | 485.70 g/mol |
| Exact Mass | 485.30 |
| IUPAC Name | (2E)-1,1,3,8-tetramethyl-2-[(E)-3-(1,1,3,8-tetramethylbenzo[e]indol-3-ium-2-yl)prop-2-enylidene]benzo[e]indole |
| SMILES | Cc1ccc2ccc3c(c2c1)C(C)(C)C(/C=C/C=C1/N(C)c2ccc4ccc(C)cc4c2C1(C)C)=[N+]3C |
| InChI | InChI=1S/C35H37N2/c1-22-12-14-24-16-18-28-32(26(24)20-22)34(3,4)30(36(28)7)10-9-11-31-35(5,6)33-27-21-23(2)13-15-25(27)17-19-29(33)37(31)8/h9-21H,1-8H3/q+1 |
| InChIKey | TWUPYPXAFQTLCC-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.70 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|