C35H37N2O+ — CID 59032539
2-[(E,3Z)-3-(7-methoxy-1,1,3-trimethylbenzo[e]indol-2-ylidene)prop-1-enyl]-1,1,3,7-tetramethylbenzo[e]indol-3-ium (PubChem CID 59032539) has the molecular formula C35H37N2O+ and a molecular weight of 501.69 g/mol. Its IUPAC name is 2-[(E,3Z)-3-(7-methoxy-1,1,3-trimethylbenzo[e]indol-2-ylidene)prop-1-enyl]-1,1,3,7-tetramethylbenzo[e]indol-3-ium.
| Compound Name | 2-[(E,3Z)-3-(7-methoxy-1,1,3-trimethylbenzo[e]indol-2-ylidene)prop-1-enyl]-1,1,3,7-tetramethylbenzo[e]indol-3-ium |
|---|---|
| PubChem CID | 59032539 |
| Molecular Formula | C35H37N2O+ |
| Molecular Weight | 501.69 g/mol |
| Exact Mass | 501.29 |
| IUPAC Name | 2-[(E,3Z)-3-(7-methoxy-1,1,3-trimethylbenzo[e]indol-2-ylidene)prop-1-enyl]-1,1,3,7-tetramethylbenzo[e]indol-3-ium |
| SMILES | COc1ccc2c3c(ccc2c1)N(C)/C(=C\C=C\C1=[N+](C)c2ccc4cc(C)ccc4c2C1(C)C)C3(C)C |
| InChI | InChI=1S/C35H37N2O/c1-22-12-16-26-23(20-22)13-18-28-32(26)34(2,3)30(36(28)6)10-9-11-31-35(4,5)33-27-17-15-25(38-8)21-24(27)14-19-29(33)37(31)7/h9-21H,1-8H3/q+1 |
| InChIKey | MSIASOCBDITZRZ-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 15.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.69 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|