C46H51N2+ — CID 122412298
(2Z)-2-[(E)-3-[(3E)-5,5-dimethyl-3-[(E)-4-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)but-3-en-2-ylidene]cyclohexen-1-yl]but-2-enylidene]-1,1,3-trimethylbenzo[e]indole (PubChem CID 122412298) has the molecular formula C46H51N2+ and a molecular weight of 631.93 g/mol. Its IUPAC name is (2Z)-2-[(E)-3-[(3E)-5,5-dimethyl-3-[(E)-4-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)but-3-en-2-ylidene]cyclohexen-1-yl]but-2-enylidene]-1,1,3-trimethylbenzo[e]indole.
| Compound Name | (2Z)-2-[(E)-3-[(3E)-5,5-dimethyl-3-[(E)-4-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)but-3-en-2-ylidene]cyclohexen-1-yl]but-2-enylidene]-1,1,3-trimethylbenzo[e]indole |
|---|---|
| PubChem CID | 122412298 |
| Molecular Formula | C46H51N2+ |
| Molecular Weight | 631.93 g/mol |
| Exact Mass | 631.40 |
| IUPAC Name | (2Z)-2-[(E)-3-[(3E)-5,5-dimethyl-3-[(E)-4-(1,1,3-trimethylbenzo[e]indol-3-ium-2-yl)but-3-en-2-ylidene]cyclohexen-1-yl]but-2-enylidene]-1,1,3-trimethylbenzo[e]indole |
| SMILES | C/C(=C\C=C1/N(C)c2ccc3ccccc3c2C1(C)C)C1=C/C(=C(C)/C=C/C2=[N+](C)c3ccc4ccccc4c3C2(C)C)CC(C)(C)C1 |
| InChI | InChI=1S/C46H51N2/c1-30(19-25-40-45(5,6)42-36-17-13-11-15-32(36)21-23-38(42)47(40)9)34-27-35(29-44(3,4)28-34)31(2)20-26-41-46(7,8)43-37-18-14-12-16-33(37)22-24-39(43)48(41)10/h11-27H,28-29H2,1-10H3/q+1 |
| InChIKey | GZWGRVFZFGLODD-UHFFFAOYSA-N |
| XLogP | 11.88 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.93 |
| LogP ≤ 5 | 11.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|