C38H47ClN2O4 — CID 71430739
2-[3-[5,5-dimethyl-3-[4-(1,3,3-trimethylindol-1-ium-2-yl)but-3-en-2-ylidene]cyclohexen-1-yl]but-2-enylidene]-1,3,3-trimethylindole perchlorate (PubChem CID 71430739) has the molecular formula C38H47ClN2O4 and a molecular weight of 631.26 g/mol. Its IUPAC name is 2-[3-[5,5-dimethyl-3-[4-(1,3,3-trimethylindol-1-ium-2-yl)but-3-en-2-ylidene]cyclohexen-1-yl]but-2-enylidene]-1,3,3-trimethylindole perchlorate.
| Compound Name | 2-[3-[5,5-dimethyl-3-[4-(1,3,3-trimethylindol-1-ium-2-yl)but-3-en-2-ylidene]cyclohexen-1-yl]but-2-enylidene]-1,3,3-trimethylindole perchlorate |
|---|---|
| PubChem CID | 71430739 |
| Molecular Formula | C38H47ClN2O4 |
| Molecular Weight | 631.26 g/mol |
| Exact Mass | 630.32 |
| IUPAC Name | 2-[3-[5,5-dimethyl-3-[4-(1,3,3-trimethylindol-1-ium-2-yl)but-3-en-2-ylidene]cyclohexen-1-yl]but-2-enylidene]-1,3,3-trimethylindole perchlorate |
| SMILES | CC(=CC=C1N(C)c2ccccc2C1(C)C)C1=CC(=C(C)C=CC2=[N+](C)c3ccccc3C2(C)C)CC(C)(C)C1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C38H47N2.ClHO4/c1-26(19-21-34-37(5,6)30-15-11-13-17-32(30)39(34)9)28-23-29(25-36(3,4)24-28)27(2)20-22-35-38(7,8)31-16-12-14-18-33(31)40(35)10;2-1(3,4)5/h11-23H,24-25H2,1-10H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | GHRZFFMTTAJQCR-UHFFFAOYSA-M |
| XLogP | 4.81 |
| TPSA | 98.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.26 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|