C36H37N2O3+ — CID 45155773
[2-[(E,4Z)-2-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-4-(1,3,3-trimethylindol-2-ylidene)but-2-enoyl]phenyl] acetate (PubChem CID 45155773) has the molecular formula C36H37N2O3+ and a molecular weight of 545.70 g/mol. Its IUPAC name is [2-[(E,4Z)-2-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-4-(1,3,3-trimethylindol-2-ylidene)but-2-enoyl]phenyl] acetate.
| Compound Name | [2-[(E,4Z)-2-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-4-(1,3,3-trimethylindol-2-ylidene)but-2-enoyl]phenyl] acetate |
|---|---|
| PubChem CID | 45155773 |
| Molecular Formula | C36H37N2O3+ |
| Molecular Weight | 545.70 g/mol |
| Exact Mass | 545.28 |
| IUPAC Name | [2-[(E,4Z)-2-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-4-(1,3,3-trimethylindol-2-ylidene)but-2-enoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1C(=O)C(/C=C/C1=[N+](C)c2ccccc2C1(C)C)=C/C=C1\N(C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C36H37N2O3/c1-24(39)41-31-19-13-8-14-26(31)34(40)25(20-22-32-35(2,3)27-15-9-11-17-29(27)37(32)6)21-23-33-36(4,5)28-16-10-12-18-30(28)38(33)7/h8-23H,1-7H3/q+1 |
| InChIKey | CFEHSYOPBAQBRQ-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.70 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|