C30H25N2O3S2+ — CID 45155775
[2-[(E,4E)-2-[(E)-2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-4-(3-methyl-1,3-benzothiazol-2-ylidene)but-2-enoyl]phenyl] acetate (PubChem CID 45155775) has the molecular formula C30H25N2O3S2+ and a molecular weight of 525.68 g/mol. Its IUPAC name is [2-[(E,4E)-2-[(E)-2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-4-(3-methyl-1,3-benzothiazol-2-ylidene)but-2-enoyl]phenyl] acetate.
| Compound Name | [2-[(E,4E)-2-[(E)-2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-4-(3-methyl-1,3-benzothiazol-2-ylidene)but-2-enoyl]phenyl] acetate |
|---|---|
| PubChem CID | 45155775 |
| Molecular Formula | C30H25N2O3S2+ |
| Molecular Weight | 525.68 g/mol |
| Exact Mass | 525.13 |
| IUPAC Name | [2-[(E,4E)-2-[(E)-2-(3-methyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-4-(3-methyl-1,3-benzothiazol-2-ylidene)but-2-enoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1C(=O)C(/C=C/c1sc2ccccc2[n+]1C)=C/C=C1/Sc2ccccc2N1C |
| InChI | InChI=1S/C30H25N2O3S2/c1-20(33)35-25-13-7-4-10-22(25)30(34)21(16-18-28-31(2)23-11-5-8-14-26(23)36-28)17-19-29-32(3)24-12-6-9-15-27(24)37-29/h4-19H,1-3H3/q+1 |
| InChIKey | PIMKVSIEIFEFQU-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.68 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|