C33H32N3OS3+ — CID 177476692
(E,1E)-8-(3-methyl-1,3-benzothiazol-3-ium-2-yl)-1-(3-methyl-1,3-benzothiazol-2-ylidene)-7-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]oct-7-en-2-one (PubChem CID 177476692) has the molecular formula C33H32N3OS3+ and a molecular weight of 582.84 g/mol. Its IUPAC name is (E,1E)-8-(3-methyl-1,3-benzothiazol-3-ium-2-yl)-1-(3-methyl-1,3-benzothiazol-2-ylidene)-7-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]oct-7-en-2-one.
| Compound Name | (E,1E)-8-(3-methyl-1,3-benzothiazol-3-ium-2-yl)-1-(3-methyl-1,3-benzothiazol-2-ylidene)-7-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]oct-7-en-2-one |
|---|---|
| PubChem CID | 177476692 |
| Molecular Formula | C33H32N3OS3+ |
| Molecular Weight | 582.84 g/mol |
| Exact Mass | 582.17 |
| IUPAC Name | (E,1E)-8-(3-methyl-1,3-benzothiazol-3-ium-2-yl)-1-(3-methyl-1,3-benzothiazol-2-ylidene)-7-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]oct-7-en-2-one |
| SMILES | CN1/C(=C/C(=C/c2sc3ccccc3[n+]2C)CCCCC(=O)/C=C2/Sc3ccccc3N2C)Sc2ccccc21 |
| InChI | InChI=1S/C33H32N3OS3/c1-34-25-14-6-9-17-28(25)38-31(34)20-23(21-32-35(2)26-15-7-10-18-29(26)39-32)12-4-5-13-24(37)22-33-36(3)27-16-8-11-19-30(27)40-33/h6-11,14-22H,4-5,12-13H2,1-3H3/q+1/b33-22+ |
| InChIKey | JIFCIGRHLJPTMZ-STKMKYKTSA-N |
| XLogP | 8.41 |
| TPSA | 27.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.84 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|