C38H36N4S4+2 — CID 72610744
2-[1,6-bis(3-methyl-1,3-benzothiazol-3-ium-2-yl)-6-(3-methyl-1,3-benzothiazol-2-ylidene)hexylidene]-3-methyl-1,3-benzothiazole (PubChem CID 72610744) has the molecular formula C38H36N4S4+2 and a molecular weight of 677.00 g/mol. Its IUPAC name is 2-[1,6-bis(3-methyl-1,3-benzothiazol-3-ium-2-yl)-6-(3-methyl-1,3-benzothiazol-2-ylidene)hexylidene]-3-methyl-1,3-benzothiazole.
| Compound Name | 2-[1,6-bis(3-methyl-1,3-benzothiazol-3-ium-2-yl)-6-(3-methyl-1,3-benzothiazol-2-ylidene)hexylidene]-3-methyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 72610744 |
| Molecular Formula | C38H36N4S4+2 |
| Molecular Weight | 677.00 g/mol |
| Exact Mass | 676.18 |
| IUPAC Name | 2-[1,6-bis(3-methyl-1,3-benzothiazol-3-ium-2-yl)-6-(3-methyl-1,3-benzothiazol-2-ylidene)hexylidene]-3-methyl-1,3-benzothiazole |
| SMILES | CN1C(=C(CCCCC(=C2Sc3ccccc3N2C)c2sc3ccccc3[n+]2C)c2sc3ccccc3[n+]2C)Sc2ccccc21 |
| InChI | InChI=1S/C38H36N4S4/c1-39-27-17-7-11-21-31(27)43-35(39)25(36-40(2)28-18-8-12-22-32(28)44-36)15-5-6-16-26(37-41(3)29-19-9-13-23-33(29)45-37)38-42(4)30-20-10-14-24-34(30)46-38/h7-14,17-24H,5-6,15-16H2,1-4H3/q+2 |
| InChIKey | CXLULHXHKHBIOR-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 14.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.00 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|