C21H17N5S — CID 154090160
[(3-methyl-1,3-benzothiazol-2-ylidene)-phenyldiazenylmethyl]-phenyldiazene (PubChem CID 154090160) has the molecular formula C21H17N5S and a molecular weight of 371.47 g/mol. Its IUPAC name is [(3-methyl-1,3-benzothiazol-2-ylidene)-phenyldiazenylmethyl]-phenyldiazene.
| Compound Name | [(3-methyl-1,3-benzothiazol-2-ylidene)-phenyldiazenylmethyl]-phenyldiazene |
|---|---|
| PubChem CID | 154090160 |
| Molecular Formula | C21H17N5S |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | [(3-methyl-1,3-benzothiazol-2-ylidene)-phenyldiazenylmethyl]-phenyldiazene |
| SMILES | CN1C(=C(/N=N/c2ccccc2)/N=N/c2ccccc2)Sc2ccccc21 |
| InChI | InChI=1S/C21H17N5S/c1-26-18-14-8-9-15-19(18)27-21(26)20(24-22-16-10-4-2-5-11-16)25-23-17-12-6-3-7-13-17/h2-15H,1H3/b24-22+,25-23+ |
| InChIKey | KTWINXMRTGKIGO-BQASJOSNSA-N |
| XLogP | 6.92 |
| TPSA | 52.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|