C19H24N3OS+ — CID 9460637
(2Z)-4-(azocan-1-ium-1-yl)-2-(3-methyl-1,3-benzothiazol-2-ylidene)-3-oxobutanenitrile (PubChem CID 9460637) has the molecular formula C19H24N3OS+ and a molecular weight of 342.49 g/mol. Its IUPAC name is (2Z)-4-(azocan-1-ium-1-yl)-2-(3-methyl-1,3-benzothiazol-2-ylidene)-3-oxobutanenitrile.
| Compound Name | (2Z)-4-(azocan-1-ium-1-yl)-2-(3-methyl-1,3-benzothiazol-2-ylidene)-3-oxobutanenitrile |
|---|---|
| PubChem CID | 9460637 |
| Molecular Formula | C19H24N3OS+ |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | (2Z)-4-(azocan-1-ium-1-yl)-2-(3-methyl-1,3-benzothiazol-2-ylidene)-3-oxobutanenitrile |
| SMILES | CN1/C(=C(\C#N)C(=O)C[NH+]2CCCCCCC2)Sc2ccccc21 |
| InChI | InChI=1S/C19H23N3OS/c1-21-16-9-5-6-10-18(16)24-19(21)15(13-20)17(23)14-22-11-7-3-2-4-8-12-22/h5-6,9-10H,2-4,7-8,11-12,14H2,1H3/p+1/b19-15- |
| InChIKey | KCCIEJUHDAVOFR-CYVLTUHYSA-O |
| XLogP | 2.38 |
| TPSA | 48.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|