C15H12N4OS3 — CID 4806417
2-(3-methyl-1,3-benzothiazol-2-ylidene)-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-3-oxobutanenitrile (PubChem CID 4806417) has the molecular formula C15H12N4OS3 and a molecular weight of 360.49 g/mol. Its IUPAC name is 2-(3-methyl-1,3-benzothiazol-2-ylidene)-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-3-oxobutanenitrile.
| Compound Name | 2-(3-methyl-1,3-benzothiazol-2-ylidene)-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-3-oxobutanenitrile |
|---|---|
| PubChem CID | 4806417 |
| Molecular Formula | C15H12N4OS3 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | 2-(3-methyl-1,3-benzothiazol-2-ylidene)-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-3-oxobutanenitrile |
| SMILES | Cc1nnc(SCC(=O)C(C#N)=C2Sc3ccccc3N2C)s1 |
| InChI | InChI=1S/C15H12N4OS3/c1-9-17-18-15(22-9)21-8-12(20)10(7-16)14-19(2)11-5-3-4-6-13(11)23-14/h3-6H,8H2,1-2H3 |
| InChIKey | WGNDMTFZTOLVGM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 69.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|